C23H17ClF4N2O6 — CID 15278962
methyl 2-[4-[5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]phenoxy]propanoate (PubChem CID 15278962) has the molecular formula C23H17ClF4N2O6 and a molecular weight of 528.84 g/mol. Its IUPAC name is methyl 2-[4-[5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]phenoxy]propanoate.
| Compound Name | methyl 2-[4-[5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]phenoxy]propanoate |
|---|---|
| PubChem CID | 15278962 |
| Molecular Formula | C23H17ClF4N2O6 |
| Molecular Weight | 528.84 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | methyl 2-[4-[5-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]-2-nitroanilino]phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1ccc(Nc2cc(Oc3c(F)cc(C(F)(F)F)cc3Cl)ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H17ClF4N2O6/c1-12(22(31)34-2)35-15-5-3-14(4-6-15)29-19-11-16(7-8-20(19)30(32)33)36-21-17(24)9-13(10-18(21)25)23(26,27)28/h3-12,29H,1-2H3 |
| InChIKey | XLOOVDAFCWPWJG-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.84 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|