C16H11ClF4O4 — CID 67881161
(2R)-2-[3-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]phenoxy]propanoic acid (PubChem CID 67881161) has the molecular formula C16H11ClF4O4 and a molecular weight of 378.71 g/mol. Its IUPAC name is (2R)-2-[3-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[3-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 67881161 |
| Molecular Formula | C16H11ClF4O4 |
| Molecular Weight | 378.71 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | (2R)-2-[3-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]phenoxy]propanoic acid |
| SMILES | C[C@@H](Oc1cccc(Oc2c(F)cc(C(F)(F)F)cc2Cl)c1)C(=O)O |
| InChI | InChI=1S/C16H11ClF4O4/c1-8(15(22)23)24-10-3-2-4-11(7-10)25-14-12(17)5-9(6-13(14)18)16(19,20)21/h2-8H,1H3,(H,22,23)/t8-/m1/s1 |
| InChIKey | YGBHMRKPQZDVPG-MRVPVSSYSA-N |
| XLogP | 5.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.71 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |