C33H20Cl2F8N4O3 — CID 139624510
2,6-bis[3-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]phenyl]-3,5-didiazoheptan-4-one (PubChem CID 139624510) has the molecular formula C33H20Cl2F8N4O3 and a molecular weight of 743.44 g/mol. Its IUPAC name is 2,6-bis[3-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]phenyl]-3,5-didiazoheptan-4-one.
| Compound Name | 2,6-bis[3-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]phenyl]-3,5-didiazoheptan-4-one |
|---|---|
| PubChem CID | 139624510 |
| Molecular Formula | C33H20Cl2F8N4O3 |
| Molecular Weight | 743.44 g/mol |
| Exact Mass | 742.08 |
| IUPAC Name | 2,6-bis[3-[2-chloro-6-fluoro-4-(trifluoromethyl)phenoxy]phenyl]-3,5-didiazoheptan-4-one |
| SMILES | CC(C(=[N+]=[N-])C(=O)C(=[N+]=[N-])C(C)c1cccc(Oc2c(F)cc(C(F)(F)F)cc2Cl)c1)c1cccc(Oc2c(F)cc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C33H20Cl2F8N4O3/c1-15(17-5-3-7-21(9-17)49-30-23(34)11-19(13-25(30)36)32(38,39)40)27(46-44)29(48)28(47-45)16(2)18-6-4-8-22(10-18)50-31-24(35)12-20(14-26(31)37)33(41,42)43/h3-16H,1-2H3 |
| InChIKey | GFEUVOCVBUZRRY-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.44 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|