methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate

C16H13Cl3O4 — CID 57018174

IUPACmethyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate
SMILESCOC(=O)C(C)Oc1cccc(Oc2c(Cl)cc(Cl)cc2Cl)c1
InChIInChI=1S/C16H13Cl3O4/c1-9(16(20)21-2)22-11-4-3-5-12(8-11)23-15-13(18)6-10(17)7-14(15)19/h3-9H,1-2H3
InChIKeyARVUEVRLKCUIHA-UHFFFAOYSA-N
MW375.64 g/mol
LogP5.38
Rot. Bonds5

About methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate

methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate (PubChem CID 57018174) has the molecular formula C16H13Cl3O4 and a molecular weight of 375.64 g/mol. Its IUPAC name is methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate.

Molecular Properties

Compound Namemethyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate
PubChem CID57018174
Molecular FormulaC16H13Cl3O4
Molecular Weight375.64 g/mol
Exact Mass373.99
IUPAC Namemethyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate
SMILESCOC(=O)C(C)Oc1cccc(Oc2c(Cl)cc(Cl)cc2Cl)c1
InChIInChI=1S/C16H13Cl3O4/c1-9(16(20)21-2)22-11-4-3-5-12(8-11)23-15-13(18)6-10(17)7-14(15)19/h3-9H,1-2H3
InChIKeyARVUEVRLKCUIHA-UHFFFAOYSA-N
XLogP5.38
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500375.64
LogP ≤ 55.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate?
The IUPAC name of methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate (CID 57018174) is methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate.
What is the SMILES notation for methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate?
The canonical SMILES for methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate is COC(=O)C(C)Oc1cccc(Oc2c(Cl)cc(Cl)cc2Cl)c1.
What is the InChIKey of methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate?
The InChIKey is ARVUEVRLKCUIHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl3O4/c1-9(16(20)21-2)22-11-4-3-5-12(8-11)23-15-13(18)6-10(17)7-14(15)19/h3-9H,1-2H3.
What are the key properties of methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate?
methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate has a molecular weight of 375.64 g/mol, XLogP of 5.38, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(2,4,6-trichlorophenoxy)phenoxy]propanoate is sourced from PubChem (CID 57018174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).