C15H12Cl2O5 — CID 71391068
2-[4-(2,4-dichloro-6-hydroxyphenoxy)phenoxy]propanoic acid (PubChem CID 71391068) has the molecular formula C15H12Cl2O5 and a molecular weight of 343.16 g/mol. Its IUPAC name is 2-[4-(2,4-dichloro-6-hydroxyphenoxy)phenoxy]propanoic acid.
| Compound Name | 2-[4-(2,4-dichloro-6-hydroxyphenoxy)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 71391068 |
| Molecular Formula | C15H12Cl2O5 |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2-[4-(2,4-dichloro-6-hydroxyphenoxy)phenoxy]propanoic acid |
| SMILES | CC(Oc1ccc(Oc2c(O)cc(Cl)cc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C15H12Cl2O5/c1-8(15(19)20)21-10-2-4-11(5-3-10)22-14-12(17)6-9(16)7-13(14)18/h2-8,18H,1H3,(H,19,20) |
| InChIKey | SNHIETHIRHERMR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |