C14H11ClFNNaO4 — CID 67929203
CID 67929203 (PubChem CID 67929203) has the molecular formula C14H11ClFNNaO4 and a molecular weight of 334.69 g/mol.
| Compound Name | CID 67929203 |
|---|---|
| PubChem CID | 67929203 |
| Molecular Formula | C14H11ClFNNaO4 |
| Molecular Weight | 334.69 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | — |
| SMILES | CC(Oc1ccc(Oc2ncc(Cl)cc2F)cc1)C(=O)O.[Na] |
| InChI | InChI=1S/C14H11ClFNO4.Na/c1-8(14(18)19)20-10-2-4-11(5-3-10)21-13-12(16)6-9(15)7-17-13;/h2-8H,1H3,(H,18,19); |
| InChIKey | KODNIMIQDGTLRW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.69 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |