C20H21ClFNO6S — CID 54012610
(2-butoxy-2-oxoethyl)sulfanyl 2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoate (PubChem CID 54012610) has the molecular formula C20H21ClFNO6S and a molecular weight of 457.91 g/mol. Its IUPAC name is (2-butoxy-2-oxoethyl)sulfanyl 2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoate.
| Compound Name | (2-butoxy-2-oxoethyl)sulfanyl 2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 54012610 |
| Molecular Formula | C20H21ClFNO6S |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | (2-butoxy-2-oxoethyl)sulfanyl 2-[4-[(5-chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoate |
| SMILES | CCCCOC(=O)CSOC(=O)C(C)Oc1ccc(Oc2ncc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C20H21ClFNO6S/c1-3-4-9-26-18(24)12-30-29-20(25)13(2)27-15-5-7-16(8-6-15)28-19-17(22)10-14(21)11-23-19/h5-8,10-11,13H,3-4,9,12H2,1-2H3 |
| InChIKey | KTKNLUDVVHTDFK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|