C17H18ClNO4 — CID 67661567
ethyl 2-[4-[(3-chloro-5-methyl-2-pyridinyl)oxy]phenoxy]propanoate (PubChem CID 67661567) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is ethyl 2-[4-[(3-chloro-5-methyl-2-pyridinyl)oxy]phenoxy]propanoate.
| Compound Name | ethyl 2-[4-[(3-chloro-5-methyl-2-pyridinyl)oxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 67661567 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | ethyl 2-[4-[(3-chloro-5-methyl-2-pyridinyl)oxy]phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1ccc(Oc2ncc(C)cc2Cl)cc1 |
| InChI | InChI=1S/C17H18ClNO4/c1-4-21-17(20)12(3)22-13-5-7-14(8-6-13)23-16-15(18)9-11(2)10-19-16/h5-10,12H,4H2,1-3H3 |
| InChIKey | UWQIRHAEQLZAQP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |