C17H15ClF3NO5 — CID 67846451
methoxymethyl 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate (PubChem CID 67846451) has the molecular formula C17H15ClF3NO5 and a molecular weight of 405.76 g/mol. Its IUPAC name is methoxymethyl 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate.
| Compound Name | methoxymethyl 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 67846451 |
| Molecular Formula | C17H15ClF3NO5 |
| Molecular Weight | 405.76 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | methoxymethyl 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
| SMILES | COCOC(=O)C(C)Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C17H15ClF3NO5/c1-10(16(23)25-9-24-2)26-12-3-5-13(6-4-12)27-15-14(18)7-11(8-22-15)17(19,20)21/h3-8,10H,9H2,1-2H3 |
| InChIKey | KXUGBMCGDBJFHG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.76 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|