C18H15ClF3NO4 — CID 54039823
(5R)-5-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]hexane-2,4-dione (PubChem CID 54039823) has the molecular formula C18H15ClF3NO4 and a molecular weight of 401.77 g/mol. Its IUPAC name is (5R)-5-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]hexane-2,4-dione.
| Compound Name | (5R)-5-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]hexane-2,4-dione |
|---|---|
| PubChem CID | 54039823 |
| Molecular Formula | C18H15ClF3NO4 |
| Molecular Weight | 401.77 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | (5R)-5-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]hexane-2,4-dione |
| SMILES | CC(=O)CC(=O)[C@@H](C)Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C18H15ClF3NO4/c1-10(24)7-16(25)11(2)26-13-3-5-14(6-4-13)27-17-15(19)8-12(9-23-17)18(20,21)22/h3-6,8-9,11H,7H2,1-2H3/t11-/m1/s1 |
| InChIKey | LLNUEBLJKJKFPS-LLVKDONJSA-N |
| XLogP | 4.86 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.77 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|