C27H18ClF3N2O7 — CID 14498577
[4-(4-nitrophenoxy)phenyl] 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate (PubChem CID 14498577) has the molecular formula C27H18ClF3N2O7 and a molecular weight of 574.90 g/mol. Its IUPAC name is [4-(4-nitrophenoxy)phenyl] 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate.
| Compound Name | [4-(4-nitrophenoxy)phenyl] 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 14498577 |
| Molecular Formula | C27H18ClF3N2O7 |
| Molecular Weight | 574.90 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | [4-(4-nitrophenoxy)phenyl] 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
| SMILES | CC(Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1)C(=O)Oc1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H18ClF3N2O7/c1-16(26(34)40-23-12-8-21(9-13-23)38-20-4-2-18(3-5-20)33(35)36)37-19-6-10-22(11-7-19)39-25-24(28)14-17(15-32-25)27(29,30)31/h2-16H,1H3 |
| InChIKey | FXDMDASOIXGNKV-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 110.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.90 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|