C22H19ClF3N5O5 — CID 141423405
2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-N-[6-(ethylamino)-3-nitro-2-pyridinyl]propanamide (PubChem CID 141423405) has the molecular formula C22H19ClF3N5O5 and a molecular weight of 525.87 g/mol. Its IUPAC name is 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-N-[6-(ethylamino)-3-nitro-2-pyridinyl]propanamide.
| Compound Name | 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-N-[6-(ethylamino)-3-nitro-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 141423405 |
| Molecular Formula | C22H19ClF3N5O5 |
| Molecular Weight | 525.87 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-N-[6-(ethylamino)-3-nitro-2-pyridinyl]propanamide |
| SMILES | CCNc1ccc([N+](=O)[O-])c(NC(=O)C(C)Oc2ccc(Oc3ncc(C(F)(F)F)cc3Cl)cc2)n1 |
| InChI | InChI=1S/C22H19ClF3N5O5/c1-3-27-18-9-8-17(31(33)34)19(29-18)30-20(32)12(2)35-14-4-6-15(7-5-14)36-21-16(23)10-13(11-28-21)22(24,25)26/h4-12H,3H2,1-2H3,(H2,27,29,30,32) |
| InChIKey | ZCUPKMXSRQPRPL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.87 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|