C20H23ClF3N2O6P — CID 14030479
2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-N-(diethoxyphosphorylmethyl)propanamide (PubChem CID 14030479) has the molecular formula C20H23ClF3N2O6P and a molecular weight of 510.83 g/mol. Its IUPAC name is 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-N-(diethoxyphosphorylmethyl)propanamide.
| Compound Name | 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-N-(diethoxyphosphorylmethyl)propanamide |
|---|---|
| PubChem CID | 14030479 |
| Molecular Formula | C20H23ClF3N2O6P |
| Molecular Weight | 510.83 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 2-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-N-(diethoxyphosphorylmethyl)propanamide |
| SMILES | CCOP(=O)(CNC(=O)C(C)Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1)OCC |
| InChI | InChI=1S/C20H23ClF3N2O6P/c1-4-29-33(28,30-5-2)12-26-18(27)13(3)31-15-6-8-16(9-7-15)32-19-17(21)10-14(11-25-19)20(22,23)24/h6-11,13H,4-5,12H2,1-3H3,(H,26,27) |
| InChIKey | ZAUCUMUHYKDMJD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.83 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|