C20H24F3N2O6P — CID 14030482
N-(diethoxyphosphorylmethyl)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanamide (PubChem CID 14030482) has the molecular formula C20H24F3N2O6P and a molecular weight of 476.39 g/mol. Its IUPAC name is N-(diethoxyphosphorylmethyl)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanamide.
| Compound Name | N-(diethoxyphosphorylmethyl)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanamide |
|---|---|
| PubChem CID | 14030482 |
| Molecular Formula | C20H24F3N2O6P |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-(diethoxyphosphorylmethyl)-2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanamide |
| SMILES | CCOP(=O)(CNC(=O)C(C)Oc1ccc(Oc2ccc(C(F)(F)F)cn2)cc1)OCC |
| InChI | InChI=1S/C20H24F3N2O6P/c1-4-28-32(27,29-5-2)13-25-19(26)14(3)30-16-7-9-17(10-8-16)31-18-11-6-15(12-24-18)20(21,22)23/h6-12,14H,4-5,13H2,1-3H3,(H,25,26) |
| InChIKey | YWKBXYNNFDQIFY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|