C17H19F3NO5P — CID 86623917
diethoxyphosphoryl-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methanol (PubChem CID 86623917) has the molecular formula C17H19F3NO5P and a molecular weight of 405.31 g/mol. Its IUPAC name is diethoxyphosphoryl-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methanol.
| Compound Name | diethoxyphosphoryl-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methanol |
|---|---|
| PubChem CID | 86623917 |
| Molecular Formula | C17H19F3NO5P |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | diethoxyphosphoryl-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methanol |
| SMILES | CCOP(=O)(OCC)C(O)c1cccc(Oc2ccc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C17H19F3NO5P/c1-3-24-27(23,25-4-2)16(22)12-6-5-7-14(10-12)26-15-9-8-13(11-21-15)17(18,19)20/h5-11,16,22H,3-4H2,1-2H3 |
| InChIKey | GPWXEMKAISUZDD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|