C20H23F3NO7P — CID 13325076
diethoxyphosphorylmethyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate (PubChem CID 13325076) has the molecular formula C20H23F3NO7P and a molecular weight of 477.37 g/mol. Its IUPAC name is diethoxyphosphorylmethyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate.
| Compound Name | diethoxyphosphorylmethyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 13325076 |
| Molecular Formula | C20H23F3NO7P |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | diethoxyphosphorylmethyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
| SMILES | CCOP(=O)(COC(=O)C(C)Oc1ccc(Oc2ccc(C(F)(F)F)cn2)cc1)OCC |
| InChI | InChI=1S/C20H23F3NO7P/c1-4-28-32(26,29-5-2)13-27-19(25)14(3)30-16-7-9-17(10-8-16)31-18-11-6-15(12-24-18)20(21,22)23/h6-12,14H,4-5,13H2,1-3H3 |
| InChIKey | GJRHKOWJTPMBMB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|