C21H23F3N2O4 — CID 70489776
ethyl (Z)-3-(ethylamino)-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]pent-2-enoate (PubChem CID 70489776) has the molecular formula C21H23F3N2O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is ethyl (Z)-3-(ethylamino)-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]pent-2-enoate.
| Compound Name | ethyl (Z)-3-(ethylamino)-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]pent-2-enoate |
|---|---|
| PubChem CID | 70489776 |
| Molecular Formula | C21H23F3N2O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | ethyl (Z)-3-(ethylamino)-4-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]pent-2-enoate |
| SMILES | CCN/C(=C\C(=O)OCC)C(C)Oc1ccc(Oc2ccc(C(F)(F)F)cn2)cc1 |
| InChI | InChI=1S/C21H23F3N2O4/c1-4-25-18(12-20(27)28-5-2)14(3)29-16-7-9-17(10-8-16)30-19-11-6-15(13-26-19)21(22,23)24/h6-14,25H,4-5H2,1-3H3/b18-12- |
| InChIKey | PAPNAALFXLCVMM-PDGQHHTCSA-N |
| XLogP | 4.72 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|