C20H21ClF2N2O6 — CID 70454566
1-(methoxycarbonylamino)propan-2-yl 2-[4-[[5-[chloro(difluoro)methyl]-2-pyridinyl]oxy]phenoxy]propanoate (PubChem CID 70454566) has the molecular formula C20H21ClF2N2O6 and a molecular weight of 458.85 g/mol. Its IUPAC name is 1-(methoxycarbonylamino)propan-2-yl 2-[4-[[5-[chloro(difluoro)methyl]-2-pyridinyl]oxy]phenoxy]propanoate.
| Compound Name | 1-(methoxycarbonylamino)propan-2-yl 2-[4-[[5-[chloro(difluoro)methyl]-2-pyridinyl]oxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 70454566 |
| Molecular Formula | C20H21ClF2N2O6 |
| Molecular Weight | 458.85 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 1-(methoxycarbonylamino)propan-2-yl 2-[4-[[5-[chloro(difluoro)methyl]-2-pyridinyl]oxy]phenoxy]propanoate |
| SMILES | COC(=O)NCC(C)OC(=O)C(C)Oc1ccc(Oc2ccc(C(F)(F)Cl)cn2)cc1 |
| InChI | InChI=1S/C20H21ClF2N2O6/c1-12(10-25-19(27)28-3)29-18(26)13(2)30-15-5-7-16(8-6-15)31-17-9-4-14(11-24-17)20(21,22)23/h4-9,11-13H,10H2,1-3H3,(H,25,27) |
| InChIKey | XQJFRVXSYXLIOF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|