C21H20ClF3O5 — CID 13279410
ethyl (Z)-4-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]-3-methoxypent-2-enoate (PubChem CID 13279410) has the molecular formula C21H20ClF3O5 and a molecular weight of 444.83 g/mol. Its IUPAC name is ethyl (Z)-4-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]-3-methoxypent-2-enoate.
| Compound Name | ethyl (Z)-4-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]-3-methoxypent-2-enoate |
|---|---|
| PubChem CID | 13279410 |
| Molecular Formula | C21H20ClF3O5 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | ethyl (Z)-4-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]-3-methoxypent-2-enoate |
| SMILES | CCOC(=O)/C=C(\OC)C(C)Oc1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C21H20ClF3O5/c1-4-28-20(26)12-19(27-3)13(2)29-15-6-8-16(9-7-15)30-18-10-5-14(11-17(18)22)21(23,24)25/h5-13H,4H2,1-3H3/b19-12- |
| InChIKey | HSGNLQOUDLNCBF-UNOMPAQXSA-N |
| XLogP | 6.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|