C19H17ClF3NO5 — CID 15022451
ethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-[(E)-hydroxyiminomethyl]phenoxy]propanoate (PubChem CID 15022451) has the molecular formula C19H17ClF3NO5 and a molecular weight of 431.79 g/mol. Its IUPAC name is ethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-[(E)-hydroxyiminomethyl]phenoxy]propanoate.
| Compound Name | ethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-[(E)-hydroxyiminomethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 15022451 |
| Molecular Formula | C19H17ClF3NO5 |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | ethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-[(E)-hydroxyiminomethyl]phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1/C=N/O |
| InChI | InChI=1S/C19H17ClF3NO5/c1-3-27-18(25)11(2)28-17-9-14(6-4-12(17)10-24-26)29-16-7-5-13(8-15(16)20)19(21,22)23/h4-11,26H,3H2,1-2H3/b24-10+ |
| InChIKey | KUDAENFKSMHOFP-YSURURNPSA-N |
| XLogP | 5.29 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|