C14H8ClF3N2NaO4 — CID 88688505
CID 88688505 (PubChem CID 88688505) has the molecular formula C14H8ClF3N2NaO4 and a molecular weight of 383.67 g/mol.
| Compound Name | CID 88688505 |
|---|---|
| PubChem CID | 88688505 |
| Molecular Formula | C14H8ClF3N2NaO4 |
| Molecular Weight | 383.67 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1C=NO.[Na] |
| InChI | InChI=1S/C14H8ClF3N2O4.Na/c15-11-6-9(14(16,17)18)1-4-13(11)24-10-2-3-12(20(22)23)8(5-10)7-19-21;/h1-7,21H; |
| InChIKey | XHRPKIHDFBSEEX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 84.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.67 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|