C13H7AsClF3NO5 — CID 151683093
CID 151683093 (PubChem CID 151683093) has the molecular formula C13H7AsClF3NO5 and a molecular weight of 424.57 g/mol.
| Compound Name | CID 151683093 |
|---|---|
| PubChem CID | 151683093 |
| Molecular Formula | C13H7AsClF3NO5 |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 423.92 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1[As](=O)O |
| InChI | InChI=1S/C13H7AsClF3NO5/c15-10-5-7(13(16,17)18)1-4-12(10)24-8-2-3-11(19(22)23)9(6-8)14(20)21/h1-6H,(H,20,21) |
| InChIKey | GBSXUAWLKCBCME-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|