C20H20ClF3O3S2 — CID 57020912
S-propyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylsulfanylphenoxy]propanethioate (PubChem CID 57020912) has the molecular formula C20H20ClF3O3S2 and a molecular weight of 464.96 g/mol. Its IUPAC name is S-propyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylsulfanylphenoxy]propanethioate.
| Compound Name | S-propyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylsulfanylphenoxy]propanethioate |
|---|---|
| PubChem CID | 57020912 |
| Molecular Formula | C20H20ClF3O3S2 |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | S-propyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylsulfanylphenoxy]propanethioate |
| SMILES | CCCSC(=O)C(C)Oc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1SC |
| InChI | InChI=1S/C20H20ClF3O3S2/c1-4-9-29-19(25)12(2)26-17-11-14(6-8-18(17)28-3)27-16-7-5-13(10-15(16)21)20(22,23)24/h5-8,10-12H,4,9H2,1-3H3 |
| InChIKey | ZTXXFSWICUIFHC-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|