C20H21ClF3NO2S — CID 150927056
2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-ethylphenyl]sulfanyl-N-ethylpropanamide (PubChem CID 150927056) has the molecular formula C20H21ClF3NO2S and a molecular weight of 431.91 g/mol. Its IUPAC name is 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-ethylphenyl]sulfanyl-N-ethylpropanamide.
| Compound Name | 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-ethylphenyl]sulfanyl-N-ethylpropanamide |
|---|---|
| PubChem CID | 150927056 |
| Molecular Formula | C20H21ClF3NO2S |
| Molecular Weight | 431.91 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-ethylphenyl]sulfanyl-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)Sc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1CC |
| InChI | InChI=1S/C20H21ClF3NO2S/c1-4-13-6-8-15(11-18(13)28-12(3)19(26)25-5-2)27-17-9-7-14(10-16(17)21)20(22,23)24/h6-12H,4-5H2,1-3H3,(H,25,26) |
| InChIKey | LFFVSMUJSRNFOF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.91 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |