C16H11Cl2F3O3 — CID 13237071
2-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride (PubChem CID 13237071) has the molecular formula C16H11Cl2F3O3 and a molecular weight of 379.16 g/mol. Its IUPAC name is 2-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride.
| Compound Name | 2-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride |
|---|---|
| PubChem CID | 13237071 |
| Molecular Formula | C16H11Cl2F3O3 |
| Molecular Weight | 379.16 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 2-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride |
| SMILES | CC(Oc1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1)C(=O)Cl |
| InChI | InChI=1S/C16H11Cl2F3O3/c1-9(15(18)22)23-11-3-5-12(6-4-11)24-14-7-2-10(8-13(14)17)16(19,20)21/h2-9H,1H3 |
| InChIKey | OZLJNBZFWYGCCG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.16 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|