2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride

C16H12ClF3O3 — CID 23325091

IUPAC2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride
SMILESCC(Oc1ccc(Oc2ccccc2C(F)(F)F)cc1)C(=O)Cl
InChIInChI=1S/C16H12ClF3O3/c1-10(15(17)21)22-11-6-8-12(9-7-11)23-14-5-3-2-4-13(14)16(18,19)20/h2-10H,1H3
InChIKeyFQFHACNYTWJRJN-UHFFFAOYSA-N
MW344.72 g/mol
LogP5.03
Rot. Bonds5

About 2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride

2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride (PubChem CID 23325091) has the molecular formula C16H12ClF3O3 and a molecular weight of 344.72 g/mol. Its IUPAC name is 2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride.

Molecular Properties

Compound Name2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride
PubChem CID23325091
Molecular FormulaC16H12ClF3O3
Molecular Weight344.72 g/mol
Exact Mass344.04
IUPAC Name2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride
SMILESCC(Oc1ccc(Oc2ccccc2C(F)(F)F)cc1)C(=O)Cl
InChIInChI=1S/C16H12ClF3O3/c1-10(15(17)21)22-11-6-8-12(9-7-11)23-14-5-3-2-4-13(14)16(18,19)20/h2-10H,1H3
InChIKeyFQFHACNYTWJRJN-UHFFFAOYSA-N
XLogP5.03
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500344.72
LogP ≤ 55.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride?
The IUPAC name of 2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride (CID 23325091) is 2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride.
What is the SMILES notation for 2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride?
The canonical SMILES for 2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride is CC(Oc1ccc(Oc2ccccc2C(F)(F)F)cc1)C(=O)Cl.
What is the InChIKey of 2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride?
The InChIKey is FQFHACNYTWJRJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClF3O3/c1-10(15(17)21)22-11-6-8-12(9-7-11)23-14-5-3-2-4-13(14)16(18,19)20/h2-10H,1H3.
What are the key properties of 2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride?
2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride has a molecular weight of 344.72 g/mol, XLogP of 5.03, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(trifluoromethyl)phenoxy]phenoxy]propanoyl chloride is sourced from PubChem (CID 23325091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).