C20H11ClF6O3 — CID 88525789
2-[5-[2,3,6-trifluoro-4-(trifluoromethyl)phenoxy]naphthalen-1-yl]oxypropanoyl chloride (PubChem CID 88525789) has the molecular formula C20H11ClF6O3 and a molecular weight of 448.75 g/mol. Its IUPAC name is 2-[5-[2,3,6-trifluoro-4-(trifluoromethyl)phenoxy]naphthalen-1-yl]oxypropanoyl chloride.
| Compound Name | 2-[5-[2,3,6-trifluoro-4-(trifluoromethyl)phenoxy]naphthalen-1-yl]oxypropanoyl chloride |
|---|---|
| PubChem CID | 88525789 |
| Molecular Formula | C20H11ClF6O3 |
| Molecular Weight | 448.75 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 2-[5-[2,3,6-trifluoro-4-(trifluoromethyl)phenoxy]naphthalen-1-yl]oxypropanoyl chloride |
| SMILES | CC(Oc1cccc2c(Oc3c(F)cc(C(F)(F)F)c(F)c3F)cccc12)C(=O)Cl |
| InChI | InChI=1S/C20H11ClF6O3/c1-9(19(21)28)29-14-6-2-5-11-10(14)4-3-7-15(11)30-18-13(22)8-12(20(25,26)27)16(23)17(18)24/h2-9H,1H3 |
| InChIKey | BLTZLTPWAVIRRG-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.75 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|