C17H12ClF3O4 — CID 70608647
(Z)-2-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]but-2-enoic acid (PubChem CID 70608647) has the molecular formula C17H12ClF3O4 and a molecular weight of 372.73 g/mol. Its IUPAC name is (Z)-2-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]but-2-enoic acid.
| Compound Name | (Z)-2-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 70608647 |
| Molecular Formula | C17H12ClF3O4 |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | (Z)-2-[4-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]but-2-enoic acid |
| SMILES | C/C=C(\Oc1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C17H12ClF3O4/c1-2-14(16(22)23)24-11-4-6-12(7-5-11)25-15-8-3-10(9-13(15)18)17(19,20)21/h2-9H,1H3,(H,22,23)/b14-2- |
| InChIKey | VMXZXYLFZPEELD-VVHNFQOZSA-N |
| XLogP | 5.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|