About CID 89104061
CID 89104061 (PubChem CID 89104061) has the molecular formula C26H14BCl2F6O4
and a molecular weight of 586.10 g/mol.
Molecular Properties
| Compound Name | CID 89104061 |
| PubChem CID | 89104061 |
| Molecular Formula | C26H14BCl2F6O4 |
| Molecular Weight | 586.10 g/mol |
| Exact Mass | 585.03 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1ccc(Oc2ccc(O[B]Oc3ccc(Oc4ccc(C(F)(F)F)cc4Cl)cc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C26H14BCl2F6O4/c28-21-13-15(25(30,31)32)1-11-23(21)36-17-3-7-19(8-4-17)38-27-39-20-9-5-18(6-10-20)37-24-12-2-16(14-22(24)29)26(33,34)35/h1-14H |
| InChIKey | MMKGZAJVUODSMN-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.10 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89104061 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89104061?
The IUPAC name of CID 89104061 (CID 89104061) is not available.
What is the SMILES notation for CID 89104061?
The canonical SMILES for CID 89104061 is FC(F)(F)c1ccc(Oc2ccc(O[B]Oc3ccc(Oc4ccc(C(F)(F)F)cc4Cl)cc3)cc2)c(Cl)c1.
What is the InChIKey of CID 89104061?
The InChIKey is MMKGZAJVUODSMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H14BCl2F6O4/c28-21-13-15(25(30,31)32)1-11-23(21)36-17-3-7-19(8-4-17)38-27-39-20-9-5-18(6-10-20)37-24-12-2-16(14-22(24)29)26(33,34)35/h1-14H.
What are the key properties of CID 89104061?
CID 89104061 has a molecular weight of 586.10 g/mol, XLogP of 9.61, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89104061 is sourced from PubChem (CID 89104061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).