C14H8ClF3O4 — CID 14554243
4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-hydroxybenzoic acid (PubChem CID 14554243) has the molecular formula C14H8ClF3O4 and a molecular weight of 332.66 g/mol. Its IUPAC name is 4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-hydroxybenzoic acid.
| Compound Name | 4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 14554243 |
| Molecular Formula | C14H8ClF3O4 |
| Molecular Weight | 332.66 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 4-[2-chloro-4-(trifluoromethyl)phenoxy]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(Oc2ccc(C(F)(F)F)cc2Cl)cc1O |
| InChI | InChI=1S/C14H8ClF3O4/c15-10-5-7(14(16,17)18)1-4-12(10)22-8-2-3-9(13(20)21)11(19)6-8/h1-6,19H,(H,20,21) |
| InChIKey | ZNXUWMIFNOERPT-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |