C23H17ClF3NO5 — CID 15022509
2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-[(E)-phenoxyiminomethyl]phenoxy]propanoic acid (PubChem CID 15022509) has the molecular formula C23H17ClF3NO5 and a molecular weight of 479.84 g/mol. Its IUPAC name is 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-[(E)-phenoxyiminomethyl]phenoxy]propanoic acid.
| Compound Name | 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-[(E)-phenoxyiminomethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 15022509 |
| Molecular Formula | C23H17ClF3NO5 |
| Molecular Weight | 479.84 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-[(E)-phenoxyiminomethyl]phenoxy]propanoic acid |
| SMILES | CC(Oc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1/C=N/Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H17ClF3NO5/c1-14(22(29)30)31-21-12-18(32-20-10-8-16(11-19(20)24)23(25,26)27)9-7-15(21)13-28-33-17-5-3-2-4-6-17/h2-14H,1H3,(H,29,30)/b28-13+ |
| InChIKey | QNVYKPCCQTXNLS-XODNFHPESA-N |
| XLogP | 6.42 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.84 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|