C24H19ClF3NO5 — CID 14517120
methyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-(phenylcarbamoyl)phenoxy]propanoate (PubChem CID 14517120) has the molecular formula C24H19ClF3NO5 and a molecular weight of 493.87 g/mol. Its IUPAC name is methyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-(phenylcarbamoyl)phenoxy]propanoate.
| Compound Name | methyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-(phenylcarbamoyl)phenoxy]propanoate |
|---|---|
| PubChem CID | 14517120 |
| Molecular Formula | C24H19ClF3NO5 |
| Molecular Weight | 493.87 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | methyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-(phenylcarbamoyl)phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H19ClF3NO5/c1-14(23(31)32-2)33-21-13-17(34-20-11-8-15(12-19(20)25)24(26,27)28)9-10-18(21)22(30)29-16-6-4-3-5-7-16/h3-14H,1-2H3,(H,29,30) |
| InChIKey | XXNZJPDKMQRVSI-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.87 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |