C19H16ClF3N2O3 — CID 19086727
ethyl 2-[6-[2-chloro-4-(trifluoromethyl)phenoxy]indazol-1-yl]propanoate (PubChem CID 19086727) has the molecular formula C19H16ClF3N2O3 and a molecular weight of 412.80 g/mol. Its IUPAC name is ethyl 2-[6-[2-chloro-4-(trifluoromethyl)phenoxy]indazol-1-yl]propanoate.
| Compound Name | ethyl 2-[6-[2-chloro-4-(trifluoromethyl)phenoxy]indazol-1-yl]propanoate |
|---|---|
| PubChem CID | 19086727 |
| Molecular Formula | C19H16ClF3N2O3 |
| Molecular Weight | 412.80 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | ethyl 2-[6-[2-chloro-4-(trifluoromethyl)phenoxy]indazol-1-yl]propanoate |
| SMILES | CCOC(=O)C(C)n1ncc2ccc(Oc3ccc(C(F)(F)F)cc3Cl)cc21 |
| InChI | InChI=1S/C19H16ClF3N2O3/c1-3-27-18(26)11(2)25-16-9-14(6-4-12(16)10-24-25)28-17-7-5-13(8-15(17)20)19(21,22)23/h4-11H,3H2,1-2H3 |
| InChIKey | BTLZBQPSNLBKND-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.80 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |