C21H18Cl2F3N3O4 — CID 70263202
ethyl 2-amino-4-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]indazol-6-yl]oxy-3-oxopentanoate (PubChem CID 70263202) has the molecular formula C21H18Cl2F3N3O4 and a molecular weight of 504.29 g/mol. Its IUPAC name is ethyl 2-amino-4-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]indazol-6-yl]oxy-3-oxopentanoate.
| Compound Name | ethyl 2-amino-4-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]indazol-6-yl]oxy-3-oxopentanoate |
|---|---|
| PubChem CID | 70263202 |
| Molecular Formula | C21H18Cl2F3N3O4 |
| Molecular Weight | 504.29 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | ethyl 2-amino-4-[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]indazol-6-yl]oxy-3-oxopentanoate |
| SMILES | CCOC(=O)C(N)C(=O)C(C)Oc1ccc2cnn(-c3c(Cl)cc(C(F)(F)F)cc3Cl)c2c1 |
| InChI | InChI=1S/C21H18Cl2F3N3O4/c1-3-32-20(31)17(27)19(30)10(2)33-13-5-4-11-9-28-29(16(11)8-13)18-14(22)6-12(7-15(18)23)21(24,25)26/h4-10,17H,3,27H2,1-2H3 |
| InChIKey | ZQMYQMMCOQTJEB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|