C14H8Cl2F3N2O3P — CID 15278616
[1-[2,6-dichloro-4-(trifluoromethyl)phenyl]indazol-5-yl]phosphonic acid (PubChem CID 15278616) has the molecular formula C14H8Cl2F3N2O3P and a molecular weight of 411.10 g/mol. Its IUPAC name is [1-[2,6-dichloro-4-(trifluoromethyl)phenyl]indazol-5-yl]phosphonic acid.
| Compound Name | [1-[2,6-dichloro-4-(trifluoromethyl)phenyl]indazol-5-yl]phosphonic acid |
|---|---|
| PubChem CID | 15278616 |
| Molecular Formula | C14H8Cl2F3N2O3P |
| Molecular Weight | 411.10 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | [1-[2,6-dichloro-4-(trifluoromethyl)phenyl]indazol-5-yl]phosphonic acid |
| SMILES | O=P(O)(O)c1ccc2c(cnn2-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C14H8Cl2F3N2O3P/c15-10-4-8(14(17,18)19)5-11(16)13(10)21-12-2-1-9(25(22,23)24)3-7(12)6-20-21/h1-6H,(H2,22,23,24) |
| InChIKey | ZRFMZRDYUDNFMK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.10 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|