C17H10Cl2F3N3O4 — CID 19737188
ethyl 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-nitroindazole-6-carboxylate (PubChem CID 19737188) has the molecular formula C17H10Cl2F3N3O4 and a molecular weight of 448.18 g/mol. Its IUPAC name is ethyl 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-nitroindazole-6-carboxylate.
| Compound Name | ethyl 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-nitroindazole-6-carboxylate |
|---|---|
| PubChem CID | 19737188 |
| Molecular Formula | C17H10Cl2F3N3O4 |
| Molecular Weight | 448.18 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | ethyl 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-5-nitroindazole-6-carboxylate |
| SMILES | CCOC(=O)c1cc2c(cnn2-c2c(Cl)cc(C(F)(F)F)cc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H10Cl2F3N3O4/c1-2-29-16(26)10-6-13-8(3-14(10)25(27)28)7-23-24(13)15-11(18)4-9(5-12(15)19)17(20,21)22/h3-7H,2H2,1H3 |
| InChIKey | GFYZLXNTHQZFPB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.18 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|