C16H14Cl2F3N3O4 — CID 24729116
ethyl 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitro-3-propylpyrazole-5-carboxylate (PubChem CID 24729116) has the molecular formula C16H14Cl2F3N3O4 and a molecular weight of 440.21 g/mol. Its IUPAC name is ethyl 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitro-3-propylpyrazole-5-carboxylate.
| Compound Name | ethyl 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitro-3-propylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 24729116 |
| Molecular Formula | C16H14Cl2F3N3O4 |
| Molecular Weight | 440.21 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | ethyl 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-nitro-3-propylpyrazole-5-carboxylate |
| SMILES | CCCc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(C(=O)OCC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14Cl2F3N3O4/c1-3-5-11-13(24(26)27)14(15(25)28-4-2)23(22-11)12-9(17)6-8(7-10(12)18)16(19,20)21/h6-7H,3-5H2,1-2H3 |
| InChIKey | CNZAAJOYUANDDV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.21 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|