C20H17ClF3NO7 — CID 162227165
ethoxycarbonyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-3-propylbenzoate (PubChem CID 162227165) has the molecular formula C20H17ClF3NO7 and a molecular weight of 475.80 g/mol. Its IUPAC name is ethoxycarbonyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-3-propylbenzoate.
| Compound Name | ethoxycarbonyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-3-propylbenzoate |
|---|---|
| PubChem CID | 162227165 |
| Molecular Formula | C20H17ClF3NO7 |
| Molecular Weight | 475.80 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | ethoxycarbonyl 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitro-3-propylbenzoate |
| SMILES | CCCc1cc(Oc2ccc(C(F)(F)F)cc2Cl)cc(C(=O)OC(=O)OCC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17ClF3NO7/c1-3-5-11-8-13(31-16-7-6-12(9-15(16)21)20(22,23)24)10-14(17(11)25(28)29)18(26)32-19(27)30-4-2/h6-10H,3-5H2,1-2H3 |
| InChIKey | ZUXJZCRNGOGZRG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.80 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|