C18H15Cl2F3O3S — CID 70545672
2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]-3-(2-ethylsulfanylethyl)benzoic acid (PubChem CID 70545672) has the molecular formula C18H15Cl2F3O3S and a molecular weight of 439.28 g/mol. Its IUPAC name is 2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]-3-(2-ethylsulfanylethyl)benzoic acid.
| Compound Name | 2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]-3-(2-ethylsulfanylethyl)benzoic acid |
|---|---|
| PubChem CID | 70545672 |
| Molecular Formula | C18H15Cl2F3O3S |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]-3-(2-ethylsulfanylethyl)benzoic acid |
| SMILES | CCSCCc1cc(Oc2ccc(C(F)(F)F)cc2Cl)cc(C(=O)O)c1Cl |
| InChI | InChI=1S/C18H15Cl2F3O3S/c1-2-27-6-5-10-7-12(9-13(16(10)20)17(24)25)26-15-4-3-11(8-14(15)19)18(21,22)23/h3-4,7-9H,2,5-6H2,1H3,(H,24,25) |
| InChIKey | ZHKMJIXYVNKNND-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|