C19H17ClF3IO4 — CID 70586256
2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-iodophenoxy]-2-ethylbutanoic acid (PubChem CID 70586256) has the molecular formula C19H17ClF3IO4 and a molecular weight of 528.69 g/mol. Its IUPAC name is 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-iodophenoxy]-2-ethylbutanoic acid.
| Compound Name | 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-iodophenoxy]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 70586256 |
| Molecular Formula | C19H17ClF3IO4 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 527.98 |
| IUPAC Name | 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-iodophenoxy]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(Oc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1I)C(=O)O |
| InChI | InChI=1S/C19H17ClF3IO4/c1-3-18(4-2,17(25)26)28-16-10-12(6-7-14(16)24)27-15-8-5-11(9-13(15)20)19(21,22)23/h5-10H,3-4H2,1-2H3,(H,25,26) |
| InChIKey | JGQIZHPXDFZYPG-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|