C15H14ClF3NO4P — CID 88714897
[2-amino-5-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]-ethylphosphinic acid (PubChem CID 88714897) has the molecular formula C15H14ClF3NO4P and a molecular weight of 395.70 g/mol. Its IUPAC name is [2-amino-5-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]-ethylphosphinic acid.
| Compound Name | [2-amino-5-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]-ethylphosphinic acid |
|---|---|
| PubChem CID | 88714897 |
| Molecular Formula | C15H14ClF3NO4P |
| Molecular Weight | 395.70 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | [2-amino-5-[2-chloro-4-(trifluoromethyl)phenoxy]phenoxy]-ethylphosphinic acid |
| SMILES | CCP(=O)(O)Oc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1N |
| InChI | InChI=1S/C15H14ClF3NO4P/c1-2-25(21,22)24-14-8-10(4-5-12(14)20)23-13-6-3-9(7-11(13)16)15(17,18)19/h3-8H,2,20H2,1H3,(H,21,22) |
| InChIKey | RNNXKKUWVJRTQD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.70 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|