C15H11ClF4NO5P — CID 70555374
[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-(1-fluoroethyl)phosphinic acid (PubChem CID 70555374) has the molecular formula C15H11ClF4NO5P and a molecular weight of 427.67 g/mol. Its IUPAC name is [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-(1-fluoroethyl)phosphinic acid.
| Compound Name | [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-(1-fluoroethyl)phosphinic acid |
|---|---|
| PubChem CID | 70555374 |
| Molecular Formula | C15H11ClF4NO5P |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | [5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenyl]-(1-fluoroethyl)phosphinic acid |
| SMILES | CC(F)P(=O)(O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H11ClF4NO5P/c1-8(17)27(24,25)14-7-10(3-4-12(14)21(22)23)26-13-5-2-9(6-11(13)16)15(18,19)20/h2-8H,1H3,(H,24,25) |
| InChIKey | OBBMELZIHBTUHI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|