C20H15Cl2F3O5 — CID 56650442
[(E)-4-ethoxy-4-oxobut-2-enyl] 2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate (PubChem CID 56650442) has the molecular formula C20H15Cl2F3O5 and a molecular weight of 463.24 g/mol. Its IUPAC name is [(E)-4-ethoxy-4-oxobut-2-enyl] 2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate.
| Compound Name | [(E)-4-ethoxy-4-oxobut-2-enyl] 2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate |
|---|---|
| PubChem CID | 56650442 |
| Molecular Formula | C20H15Cl2F3O5 |
| Molecular Weight | 463.24 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | [(E)-4-ethoxy-4-oxobut-2-enyl] 2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate |
| SMILES | CCOC(=O)/C=C/COC(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C20H15Cl2F3O5/c1-2-28-18(26)4-3-9-29-19(27)14-11-13(6-7-15(14)21)30-17-8-5-12(10-16(17)22)20(23,24)25/h3-8,10-11H,2,9H2,1H3/b4-3+ |
| InChIKey | QNLVEEPULCBBEU-ONEGZZNKSA-N |
| XLogP | 6.08 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.24 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|