C30H18Cl2F6O6 — CID 14403310
2-[3-[2-chloro-4-(trifluoromethyl)phenoxy]benzoyl]oxyethyl 3-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate (PubChem CID 14403310) has the molecular formula C30H18Cl2F6O6 and a molecular weight of 659.36 g/mol. Its IUPAC name is 2-[3-[2-chloro-4-(trifluoromethyl)phenoxy]benzoyl]oxyethyl 3-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate.
| Compound Name | 2-[3-[2-chloro-4-(trifluoromethyl)phenoxy]benzoyl]oxyethyl 3-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate |
|---|---|
| PubChem CID | 14403310 |
| Molecular Formula | C30H18Cl2F6O6 |
| Molecular Weight | 659.36 g/mol |
| Exact Mass | 658.04 |
| IUPAC Name | 2-[3-[2-chloro-4-(trifluoromethyl)phenoxy]benzoyl]oxyethyl 3-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate |
| SMILES | O=C(OCCOC(=O)c1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1)c1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C30H18Cl2F6O6/c31-23-15-19(29(33,34)35)7-9-25(23)43-21-5-1-3-17(13-21)27(39)41-11-12-42-28(40)18-4-2-6-22(14-18)44-26-10-8-20(16-24(26)32)30(36,37)38/h1-10,13-16H,11-12H2 |
| InChIKey | FFBSQOFDSXHNCN-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.36 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|