C17H16ClF3N2O5 — CID 88658714
1-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]-2-methoxy-2-nitroethanone;methanamine (PubChem CID 88658714) has the molecular formula C17H16ClF3N2O5 and a molecular weight of 420.77 g/mol. Its IUPAC name is 1-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]-2-methoxy-2-nitroethanone;methanamine.
| Compound Name | 1-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]-2-methoxy-2-nitroethanone;methanamine |
|---|---|
| PubChem CID | 88658714 |
| Molecular Formula | C17H16ClF3N2O5 |
| Molecular Weight | 420.77 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 1-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]-2-methoxy-2-nitroethanone;methanamine |
| SMILES | CN.COC(C(=O)c1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1)[N+](=O)[O-] |
| InChI | InChI=1S/C16H11ClF3NO5.CH5N/c1-25-15(21(23)24)14(22)9-3-2-4-11(7-9)26-13-6-5-10(8-12(13)17)16(18,19)20;1-2/h2-8,15H,1H3;2H2,1H3 |
| InChIKey | VSXQCZYHXWZFNX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.77 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|