C17H12ClF3N2O6 — CID 56997590
4-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]-3-nitro-4-nitrosobutanoic acid (PubChem CID 56997590) has the molecular formula C17H12ClF3N2O6 and a molecular weight of 432.74 g/mol. Its IUPAC name is 4-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]-3-nitro-4-nitrosobutanoic acid.
| Compound Name | 4-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]-3-nitro-4-nitrosobutanoic acid |
|---|---|
| PubChem CID | 56997590 |
| Molecular Formula | C17H12ClF3N2O6 |
| Molecular Weight | 432.74 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 4-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]-3-nitro-4-nitrosobutanoic acid |
| SMILES | O=NC(c1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1)C(CC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C17H12ClF3N2O6/c18-12-7-10(17(19,20)21)4-5-14(12)29-11-3-1-2-9(6-11)16(22-26)13(23(27)28)8-15(24)25/h1-7,13,16H,8H2,(H,24,25) |
| InChIKey | ZCLQXEJSEWAEAL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.74 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|