C16H12ClF3O3 — CID 68675820
3-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]propanoic acid (PubChem CID 68675820) has the molecular formula C16H12ClF3O3 and a molecular weight of 344.72 g/mol. Its IUPAC name is 3-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]propanoic acid.
| Compound Name | 3-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 68675820 |
| Molecular Formula | C16H12ClF3O3 |
| Molecular Weight | 344.72 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 3-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C16H12ClF3O3/c17-13-9-11(16(18,19)20)5-6-14(13)23-12-3-1-2-10(8-12)4-7-15(21)22/h1-3,5-6,8-9H,4,7H2,(H,21,22) |
| InChIKey | KVEYFKWVTVCKMX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.72 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |