C17H16ClF3NO7P — CID 88697002
2-chloro-1-[3-(2-dimethoxyphosphoryl-1-nitroethoxy)phenoxy]-4-(trifluoromethyl)benzene (PubChem CID 88697002) has the molecular formula C17H16ClF3NO7P and a molecular weight of 469.74 g/mol. Its IUPAC name is 2-chloro-1-[3-(2-dimethoxyphosphoryl-1-nitroethoxy)phenoxy]-4-(trifluoromethyl)benzene.
| Compound Name | 2-chloro-1-[3-(2-dimethoxyphosphoryl-1-nitroethoxy)phenoxy]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 88697002 |
| Molecular Formula | C17H16ClF3NO7P |
| Molecular Weight | 469.74 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | 2-chloro-1-[3-(2-dimethoxyphosphoryl-1-nitroethoxy)phenoxy]-4-(trifluoromethyl)benzene |
| SMILES | COP(=O)(CC(Oc1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1)[N+](=O)[O-])OC |
| InChI | InChI=1S/C17H16ClF3NO7P/c1-26-30(25,27-2)10-16(22(23)24)29-13-5-3-4-12(9-13)28-15-7-6-11(8-14(15)18)17(19,20)21/h3-9,16H,10H2,1-2H3 |
| InChIKey | YNAKDXDYXVBPEC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.74 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|