C21H23ClF3N2O7P — CID 88666660
[2-amino-1-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]-3-nitro-1-oxobutan-2-yl]-butan-2-yloxyphosphinic acid (PubChem CID 88666660) has the molecular formula C21H23ClF3N2O7P and a molecular weight of 538.84 g/mol. Its IUPAC name is [2-amino-1-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]-3-nitro-1-oxobutan-2-yl]-butan-2-yloxyphosphinic acid.
| Compound Name | [2-amino-1-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]-3-nitro-1-oxobutan-2-yl]-butan-2-yloxyphosphinic acid |
|---|---|
| PubChem CID | 88666660 |
| Molecular Formula | C21H23ClF3N2O7P |
| Molecular Weight | 538.84 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | [2-amino-1-[3-[2-chloro-4-(trifluoromethyl)phenoxy]phenyl]-3-nitro-1-oxobutan-2-yl]-butan-2-yloxyphosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C(N)(C(=O)c1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C21H23ClF3N2O7P/c1-4-12(2)34-35(31,32)20(26,13(3)27(29)30)19(28)14-6-5-7-16(10-14)33-18-9-8-15(11-17(18)22)21(23,24)25/h5-13H,4,26H2,1-3H3,(H,31,32) |
| InChIKey | VZJWJPSAXSCPFF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.84 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|