C18H15ClF3NO7S — CID 70577757
ethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]-2-methylsulfinylacetate (PubChem CID 70577757) has the molecular formula C18H15ClF3NO7S and a molecular weight of 481.83 g/mol. Its IUPAC name is ethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]-2-methylsulfinylacetate.
| Compound Name | ethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]-2-methylsulfinylacetate |
|---|---|
| PubChem CID | 70577757 |
| Molecular Formula | C18H15ClF3NO7S |
| Molecular Weight | 481.83 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | ethyl 2-[5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrophenoxy]-2-methylsulfinylacetate |
| SMILES | CCOC(=O)C(Oc1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-])S(C)=O |
| InChI | InChI=1S/C18H15ClF3NO7S/c1-3-28-16(24)17(31(2)27)30-15-9-11(5-6-13(15)23(25)26)29-14-7-4-10(8-12(14)19)18(20,21)22/h4-9,17H,3H2,1-2H3 |
| InChIKey | QWGJXGHYVPGJNY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.83 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|